About dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane
dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane (PubChem CID 23413869) has the molecular formula Cl8N4P4
and a molecular weight of 463.55 g/mol. Its IUPAC name is dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane.
Molecular Properties
| Compound Name | dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane |
| PubChem CID | 23413869 |
| Molecular Formula | Cl8N4P4 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 459.66 |
| IUPAC Name | dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane |
| SMILES | ClP(Cl)N1N(P(Cl)Cl)N(P(Cl)Cl)N1P(Cl)Cl |
| InChI | InChI=1S/Cl8N4P4/c1-13(2)9-10(14(3)4)12(16(7)8)11(9)15(5)6 |
| InChIKey | KLIDCWYJXQRLIB-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane?
The IUPAC name of dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane (CID 23413869) is dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane.
What is the SMILES notation for dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane?
The canonical SMILES for dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane is ClP(Cl)N1N(P(Cl)Cl)N(P(Cl)Cl)N1P(Cl)Cl.
What is the InChIKey of dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane?
The InChIKey is KLIDCWYJXQRLIB-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl8N4P4/c1-13(2)9-10(14(3)4)12(16(7)8)11(9)15(5)6.
What are the key properties of dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane?
dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane has a molecular weight of 463.55 g/mol, XLogP of 7.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-[2,3,4-tris(dichlorophosphanyl)tetrazetidin-1-yl]phosphane is sourced from PubChem (CID 23413869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).