About (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide
(5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide (PubChem CID 23414030) has the molecular formula C4N4P-
and a molecular weight of 135.05 g/mol. Its IUPAC name is (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide.
Molecular Properties
| Compound Name | (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide |
| PubChem CID | 23414030 |
| Molecular Formula | C4N4P- |
| Molecular Weight | 135.05 g/mol |
| Exact Mass | 134.99 |
| IUPAC Name | (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide |
| SMILES | N#CC1=NP=NC1=C=[N-] |
| InChI | InChI=1S/C4N4P/c5-1-3-4(2-6)8-9-7-3/q-1 |
| InChIKey | KTEDJLHXZWDAPH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.05 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide?
The IUPAC name of (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide (CID 23414030) is (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide.
What is the SMILES notation for (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide?
The canonical SMILES for (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide is N#CC1=NP=NC1=C=[N-].
What is the InChIKey of (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide?
The InChIKey is KTEDJLHXZWDAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4N4P/c5-1-3-4(2-6)8-9-7-3/q-1.
What are the key properties of (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide?
(5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide has a molecular weight of 135.05 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-1,3,2-diazaphosphol-4-ylidene)methylideneazanide is sourced from PubChem (CID 23414030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).