About [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate (PubChem CID 2341463) has the molecular formula C17H16F3N3O3S
and a molecular weight of 399.39 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate.
Molecular Properties
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
| PubChem CID | 2341463 |
| Molecular Formula | C17H16F3N3O3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
| SMILES | Cc1cc(C)nc(SCC(=O)OCC(=O)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H16F3N3O3S/c1-10-6-11(2)22-16(21-10)27-9-15(25)26-8-14(24)23-13-5-3-4-12(7-13)17(18,19)20/h3-7H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | FMGBNYZTQZTNAR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate?
The IUPAC name of [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate (CID 2341463) is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate.
What is the SMILES notation for [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate?
The canonical SMILES for [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate is Cc1cc(C)nc(SCC(=O)OCC(=O)Nc2cccc(C(F)(F)F)c2)n1.
What is the InChIKey of [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate?
The InChIKey is FMGBNYZTQZTNAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F3N3O3S/c1-10-6-11(2)22-16(21-10)27-9-15(25)26-8-14(24)23-13-5-3-4-12(7-13)17(18,19)20/h3-7H,8-9H2,1-2H3,(H,23,24).
What are the key properties of [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate?
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate has a molecular weight of 399.39 g/mol, XLogP of 3.39, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate is sourced from PubChem (CID 2341463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).