C9H19O3P — CID 23414648
(2R,4R)-2-methoxy-5,5-dimethyl-4-propan-2-yl-1,3,2-dioxaphosphinane (PubChem CID 23414648) has the molecular formula C9H19O3P and a molecular weight of 206.22 g/mol. Its IUPAC name is (2R,4R)-2-methoxy-5,5-dimethyl-4-propan-2-yl-1,3,2-dioxaphosphinane.
| Compound Name | (2R,4R)-2-methoxy-5,5-dimethyl-4-propan-2-yl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 23414648 |
| Molecular Formula | C9H19O3P |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (2R,4R)-2-methoxy-5,5-dimethyl-4-propan-2-yl-1,3,2-dioxaphosphinane |
| SMILES | CO[P@]1OCC(C)(C)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C9H19O3P/c1-7(2)8-9(3,4)6-11-13(10-5)12-8/h7-8H,6H2,1-5H3/t8-,13-/m1/s1 |
| InChIKey | WYLFRUVGWLVNTH-AMIZOPFISA-N |
| XLogP | 2.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|