C14H14N3P — CID 23414785
3-methyl-2,5-diphenyl-4H-1,2,4,3-triazaphosphole (PubChem CID 23414785) has the molecular formula C14H14N3P and a molecular weight of 255.26 g/mol. Its IUPAC name is 3-methyl-2,5-diphenyl-4H-1,2,4,3-triazaphosphole.
| Compound Name | 3-methyl-2,5-diphenyl-4H-1,2,4,3-triazaphosphole |
|---|---|
| PubChem CID | 23414785 |
| Molecular Formula | C14H14N3P |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-methyl-2,5-diphenyl-4H-1,2,4,3-triazaphosphole |
| SMILES | CP1NC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C14H14N3P/c1-18-16-14(12-8-4-2-5-9-12)15-17(18)13-10-6-3-7-11-13/h2-11H,1H3,(H,15,16) |
| InChIKey | GMCIDHARVSLZRC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|