C16H15F5NP — CID 23414819
N-ethyl-N-[(2,3,4,5,6-pentafluorophenyl)-phenylphosphanyl]ethanamine (PubChem CID 23414819) has the molecular formula C16H15F5NP and a molecular weight of 347.27 g/mol. Its IUPAC name is N-ethyl-N-[(2,3,4,5,6-pentafluorophenyl)-phenylphosphanyl]ethanamine.
| Compound Name | N-ethyl-N-[(2,3,4,5,6-pentafluorophenyl)-phenylphosphanyl]ethanamine |
|---|---|
| PubChem CID | 23414819 |
| Molecular Formula | C16H15F5NP |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-ethyl-N-[(2,3,4,5,6-pentafluorophenyl)-phenylphosphanyl]ethanamine |
| SMILES | CCN(CC)P(c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H15F5NP/c1-3-22(4-2)23(10-8-6-5-7-9-10)16-14(20)12(18)11(17)13(19)15(16)21/h5-9H,3-4H2,1-2H3 |
| InChIKey | YZXDHIQMDWQHGD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|