C6ClF5N6P+ — CID 23415100
diazido-chloro-(2,3,4,5,6-pentafluorophenyl)phosphanium (PubChem CID 23415100) has the molecular formula C6ClF5N6P+ and a molecular weight of 317.53 g/mol. Its IUPAC name is diazido-chloro-(2,3,4,5,6-pentafluorophenyl)phosphanium.
| Compound Name | diazido-chloro-(2,3,4,5,6-pentafluorophenyl)phosphanium |
|---|---|
| PubChem CID | 23415100 |
| Molecular Formula | C6ClF5N6P+ |
| Molecular Weight | 317.53 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | diazido-chloro-(2,3,4,5,6-pentafluorophenyl)phosphanium |
| SMILES | [N-]=[N+]=N[P+](Cl)(N=[N+]=[N-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6ClF5N6P/c7-19(17-15-13,18-16-14)6-4(11)2(9)1(8)3(10)5(6)12/q+1 |
| InChIKey | JRRRUQWBZVXORR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|