C6F5N9P+ — CID 23415155
triazido-(2,3,4,5,6-pentafluorophenyl)phosphanium (PubChem CID 23415155) has the molecular formula C6F5N9P+ and a molecular weight of 324.09 g/mol. Its IUPAC name is triazido-(2,3,4,5,6-pentafluorophenyl)phosphanium.
| Compound Name | triazido-(2,3,4,5,6-pentafluorophenyl)phosphanium |
|---|---|
| PubChem CID | 23415155 |
| Molecular Formula | C6F5N9P+ |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | triazido-(2,3,4,5,6-pentafluorophenyl)phosphanium |
| SMILES | [N-]=[N+]=N[P+](N=[N+]=[N-])(N=[N+]=[N-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6F5N9P/c7-1-2(8)4(10)6(5(11)3(1)9)21(18-15-12,19-16-13)20-17-14/q+1 |
| InChIKey | MPSOJQHNIXQOTE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 146.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|