C7H15O5PS — CID 23415596
5,5-dimethyl-2-(methylsulfonylmethyl)-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 23415596) has the molecular formula C7H15O5PS and a molecular weight of 242.23 g/mol. Its IUPAC name is 5,5-dimethyl-2-(methylsulfonylmethyl)-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 5,5-dimethyl-2-(methylsulfonylmethyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 23415596 |
| Molecular Formula | C7H15O5PS |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 5,5-dimethyl-2-(methylsulfonylmethyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC1(C)COP(=O)(CS(C)(=O)=O)OC1 |
| InChI | InChI=1S/C7H15O5PS/c1-7(2)4-11-13(8,12-5-7)6-14(3,9)10/h4-6H2,1-3H3 |
| InChIKey | OGNCUSZNSRSBIG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|