C7H15O4PS — CID 23415597
5,5-dimethyl-2-(methylsulfinylmethyl)-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 23415597) has the molecular formula C7H15O4PS and a molecular weight of 226.23 g/mol. Its IUPAC name is 5,5-dimethyl-2-(methylsulfinylmethyl)-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 5,5-dimethyl-2-(methylsulfinylmethyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 23415597 |
| Molecular Formula | C7H15O4PS |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 5,5-dimethyl-2-(methylsulfinylmethyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CS(=O)CP1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C7H15O4PS/c1-7(2)4-10-12(8,11-5-7)6-13(3)9/h4-6H2,1-3H3 |
| InChIKey | AUXPOIUOCCGODE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|