About N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine
N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine (PubChem CID 23415750) has the molecular formula C4H10NOPS
and a molecular weight of 151.17 g/mol. Its IUPAC name is N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine |
| PubChem CID | 23415750 |
| Molecular Formula | C4H10NOPS |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine |
| SMILES | CN(C)P1(=O)CSC1 |
| InChI | InChI=1S/C4H10NOPS/c1-5(2)7(6)3-8-4-7/h3-4H2,1-2H3 |
| InChIKey | GXFXMWXSOUAQEC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine?
The IUPAC name of N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine (CID 23415750) is N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine.
What is the SMILES notation for N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine?
The canonical SMILES for N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine is CN(C)P1(=O)CSC1.
What is the InChIKey of N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine?
The InChIKey is GXFXMWXSOUAQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10NOPS/c1-5(2)7(6)3-8-4-7/h3-4H2,1-2H3.
What are the key properties of N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine?
N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine has a molecular weight of 151.17 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-oxo-1,3λ5-thiaphosphetan-3-amine is sourced from PubChem (CID 23415750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).