C14H15Br2O3P — CID 23415921
(5S,6S)-5,6-dibromo-1-oxo-1-phenyl-1λ5-phosphonane-3,8-dione (PubChem CID 23415921) has the molecular formula C14H15Br2O3P and a molecular weight of 422.05 g/mol. Its IUPAC name is (5S,6S)-5,6-dibromo-1-oxo-1-phenyl-1λ5-phosphonane-3,8-dione.
| Compound Name | (5S,6S)-5,6-dibromo-1-oxo-1-phenyl-1λ5-phosphonane-3,8-dione |
|---|---|
| PubChem CID | 23415921 |
| Molecular Formula | C14H15Br2O3P |
| Molecular Weight | 422.05 g/mol |
| Exact Mass | 419.91 |
| IUPAC Name | (5S,6S)-5,6-dibromo-1-oxo-1-phenyl-1λ5-phosphonane-3,8-dione |
| SMILES | O=C1C[C@H](Br)[C@@H](Br)CC(=O)CP(=O)(c2ccccc2)C1 |
| InChI | InChI=1S/C14H15Br2O3P/c15-13-6-10(17)8-20(19,9-11(18)7-14(13)16)12-4-2-1-3-5-12/h1-5,13-14H,6-9H2/t13-,14-/m0/s1 |
| InChIKey | WCBFKMJSTXCCNW-KBPBESRZSA-N |
| XLogP | 3.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.05 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|