C15H31O3PSi2 — CID 23415932
trimethyl-[[(2E,8E)-1-methyl-1-oxo-8-trimethylsilyloxy-4,5,6,7-tetrahydro-1λ5-phosphonin-3-yl]oxy]silane (PubChem CID 23415932) has the molecular formula C15H31O3PSi2 and a molecular weight of 346.56 g/mol. Its IUPAC name is trimethyl-[[(2E,8E)-1-methyl-1-oxo-8-trimethylsilyloxy-4,5,6,7-tetrahydro-1λ5-phosphonin-3-yl]oxy]silane.
| Compound Name | trimethyl-[[(2E,8E)-1-methyl-1-oxo-8-trimethylsilyloxy-4,5,6,7-tetrahydro-1λ5-phosphonin-3-yl]oxy]silane |
|---|---|
| PubChem CID | 23415932 |
| Molecular Formula | C15H31O3PSi2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | trimethyl-[[(2E,8E)-1-methyl-1-oxo-8-trimethylsilyloxy-4,5,6,7-tetrahydro-1λ5-phosphonin-3-yl]oxy]silane |
| SMILES | C[Si](C)(C)O/C1=C/P(C)(=O)/C=C(/O[Si](C)(C)C)CCCC1 |
| InChI | InChI=1S/C15H31O3PSi2/c1-19(16)12-14(17-20(2,3)4)10-8-9-11-15(13-19)18-21(5,6)7/h12-13H,8-11H2,1-7H3/b14-12+,15-13+ |
| InChIKey | MJWDIWQBUNBGHQ-QUMQEAAQSA-N |
| XLogP | 5.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|