C4H8ClO3P — CID 23416061
(4S,5R)-2-chloro-4,5-dimethyl-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 23416061) has the molecular formula C4H8ClO3P and a molecular weight of 170.53 g/mol. Its IUPAC name is (4S,5R)-2-chloro-4,5-dimethyl-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | (4S,5R)-2-chloro-4,5-dimethyl-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 23416061 |
| Molecular Formula | C4H8ClO3P |
| Molecular Weight | 170.53 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | (4S,5R)-2-chloro-4,5-dimethyl-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | C[C@@H]1OP(=O)(Cl)O[C@@H]1C |
| InChI | InChI=1S/C4H8ClO3P/c1-3-4(2)8-9(5,6)7-3/h3-4H,1-2H3/t3-,4+,9? |
| InChIKey | NWEOITOLZSNNEX-OQMOVHNOSA-N |
| XLogP | 2.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|