C6H14NO3P — CID 23416107
(2S,4S)-N,N,4-trimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine (PubChem CID 23416107) has the molecular formula C6H14NO3P and a molecular weight of 179.16 g/mol. Its IUPAC name is (2S,4S)-N,N,4-trimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine.
| Compound Name | (2S,4S)-N,N,4-trimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 23416107 |
| Molecular Formula | C6H14NO3P |
| Molecular Weight | 179.16 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (2S,4S)-N,N,4-trimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine |
| SMILES | C[C@H]1CCO[P@@](=O)(N(C)C)O1 |
| InChI | InChI=1S/C6H14NO3P/c1-6-4-5-9-11(8,10-6)7(2)3/h6H,4-5H2,1-3H3/t6-,11-/m0/s1 |
| InChIKey | XMTQJFYUASOATO-KGFZYKRKSA-N |
| XLogP | 1.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|