C16H19N2OPS — CID 23416279
(2S,4S,5R)-3,4-dimethyl-N,5-diphenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine (PubChem CID 23416279) has the molecular formula C16H19N2OPS and a molecular weight of 318.38 g/mol. Its IUPAC name is (2S,4S,5R)-3,4-dimethyl-N,5-diphenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine.
| Compound Name | (2S,4S,5R)-3,4-dimethyl-N,5-diphenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine |
|---|---|
| PubChem CID | 23416279 |
| Molecular Formula | C16H19N2OPS |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2S,4S,5R)-3,4-dimethyl-N,5-diphenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P@](=S)(Nc2ccccc2)N1C |
| InChI | InChI=1S/C16H19N2OPS/c1-13-16(14-9-5-3-6-10-14)19-20(21,18(13)2)17-15-11-7-4-8-12-15/h3-13,16H,1-2H3,(H,17,21)/t13-,16-,20-/m0/s1 |
| InChIKey | SOPBHKYDCVXJMN-RISOHXOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|