About 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane
2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane (PubChem CID 23416314) has the molecular formula C4H9OPS3
and a molecular weight of 200.29 g/mol. Its IUPAC name is 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane.
Molecular Properties
| Compound Name | 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane |
| PubChem CID | 23416314 |
| Molecular Formula | C4H9OPS3 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 199.96 |
| IUPAC Name | 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane |
| SMILES | COP1(=S)SCCCS1 |
| InChI | InChI=1S/C4H9OPS3/c1-5-6(7)8-3-2-4-9-6/h2-4H2,1H3 |
| InChIKey | PZYDGUHOKKCMFU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane?
The IUPAC name of 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane (CID 23416314) is 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane.
What is the SMILES notation for 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane?
The canonical SMILES for 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane is COP1(=S)SCCCS1.
What is the InChIKey of 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane?
The InChIKey is PZYDGUHOKKCMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9OPS3/c1-5-6(7)8-3-2-4-9-6/h2-4H2,1H3.
What are the key properties of 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane?
2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane has a molecular weight of 200.29 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-sulfanylidene-1,3,2λ5-dithiaphosphinane is sourced from PubChem (CID 23416314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).