About dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate
dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate (PubChem CID 23416426) has the molecular formula C24H39N2O6P
and a molecular weight of 482.56 g/mol. Its IUPAC name is dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate |
| PubChem CID | 23416426 |
| Molecular Formula | C24H39N2O6P |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate |
| SMILES | COC(=O)C(/C(=N/c1ccccc1)C(=O)OC)=P(OCC(C)(C)C)(OCC(C)(C)C)N(C)C |
| InChI | InChI=1S/C24H39N2O6P/c1-23(2,3)16-31-33(26(7)8,32-17-24(4,5)6)20(22(28)30-10)19(21(27)29-9)25-18-14-12-11-13-15-18/h11-15H,16-17H2,1-10H3/b25-19- |
| InChIKey | RZVRBMZWEFPURE-PLRJNAJWSA-N |
| XLogP | 4.73 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate?
The IUPAC name of dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate (CID 23416426) is dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate.
What is the SMILES notation for dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate?
The canonical SMILES for dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate is COC(=O)C(/C(=N/c1ccccc1)C(=O)OC)=P(OCC(C)(C)C)(OCC(C)(C)C)N(C)C.
What is the InChIKey of dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate?
The InChIKey is RZVRBMZWEFPURE-PLRJNAJWSA-N. The full InChI is InChI=1S/C24H39N2O6P/c1-23(2,3)16-31-33(26(7)8,32-17-24(4,5)6)20(22(28)30-10)19(21(27)29-9)25-18-14-12-11-13-15-18/h11-15H,16-17H2,1-10H3/b25-19-.
What are the key properties of dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate?
dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate has a molecular weight of 482.56 g/mol, XLogP of 4.73, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[dimethylamino-bis(2,2-dimethylpropoxy)-λ5-phosphanylidene]-3-phenyliminobutanedioate is sourced from PubChem (CID 23416426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).