C8H12O6PS- — CID 23416843
3,3,8,8-tetramethyl-5-sulfido-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,7-dione (PubChem CID 23416843) has the molecular formula C8H12O6PS- and a molecular weight of 267.22 g/mol. Its IUPAC name is 3,3,8,8-tetramethyl-5-sulfido-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,7-dione.
| Compound Name | 3,3,8,8-tetramethyl-5-sulfido-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,7-dione |
|---|---|
| PubChem CID | 23416843 |
| Molecular Formula | C8H12O6PS- |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 3,3,8,8-tetramethyl-5-sulfido-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,7-dione |
| SMILES | CC1(C)OP2([S-])(OC1=O)OC(=O)C(C)(C)O2 |
| InChI | InChI=1S/C8H12O6PS/c1-7(2)5(9)11-15(16,13-7)12-6(10)8(3,4)14-15/h1-4H3/q-1 |
| InChIKey | VHEAMAJZWWSDFT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|