About methoxy(tetraphenoxy)-λ5-phosphane
methoxy(tetraphenoxy)-λ5-phosphane (PubChem CID 23416854) has the molecular formula C25H23O5P
and a molecular weight of 434.43 g/mol. Its IUPAC name is methoxy(tetraphenoxy)-λ5-phosphane.
Molecular Properties
| Compound Name | methoxy(tetraphenoxy)-λ5-phosphane |
| PubChem CID | 23416854 |
| Molecular Formula | C25H23O5P |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | methoxy(tetraphenoxy)-λ5-phosphane |
| SMILES | COP(Oc1ccccc1)(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H23O5P/c1-26-31(27-22-14-6-2-7-15-22,28-23-16-8-3-9-17-23,29-24-18-10-4-11-19-24)30-25-20-12-5-13-21-25/h2-21H,1H3 |
| InChIKey | DTJBQWXWOYAHRJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methoxy(tetraphenoxy)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy(tetraphenoxy)-λ5-phosphane?
The IUPAC name of methoxy(tetraphenoxy)-λ5-phosphane (CID 23416854) is methoxy(tetraphenoxy)-λ5-phosphane.
What is the SMILES notation for methoxy(tetraphenoxy)-λ5-phosphane?
The canonical SMILES for methoxy(tetraphenoxy)-λ5-phosphane is COP(Oc1ccccc1)(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of methoxy(tetraphenoxy)-λ5-phosphane?
The InChIKey is DTJBQWXWOYAHRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23O5P/c1-26-31(27-22-14-6-2-7-15-22,28-23-16-8-3-9-17-23,29-24-18-10-4-11-19-24)30-25-20-12-5-13-21-25/h2-21H,1H3.
What are the key properties of methoxy(tetraphenoxy)-λ5-phosphane?
methoxy(tetraphenoxy)-λ5-phosphane has a molecular weight of 434.43 g/mol, XLogP of 7.08, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(tetraphenoxy)-λ5-phosphane is sourced from PubChem (CID 23416854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).