C8H6F13O2P — CID 23417108
2-fluoro-2,2-dimethyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholane (PubChem CID 23417108) has the molecular formula C8H6F13O2P and a molecular weight of 412.08 g/mol. Its IUPAC name is 2-fluoro-2,2-dimethyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholane.
| Compound Name | 2-fluoro-2,2-dimethyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholane |
|---|---|
| PubChem CID | 23417108 |
| Molecular Formula | C8H6F13O2P |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 2-fluoro-2,2-dimethyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholane |
| SMILES | CP1(C)(F)OC(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C8H6F13O2P/c1-24(2,21)22-3(5(9,10)11,6(12,13)14)4(23-24,7(15,16)17)8(18,19)20/h1-2H3 |
| InChIKey | OXTKKZZHFHMOEA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|