About CID 23417317
CID 23417317 (PubChem CID 23417317) has the molecular formula C36H30O6P-
and a molecular weight of 589.60 g/mol.
Molecular Properties
| Compound Name | CID 23417317 |
| PubChem CID | 23417317 |
| Molecular Formula | C36H30O6P- |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | — |
| SMILES | c1ccc(O[P-](Oc2ccccc2)(Oc2ccccc2)(Oc2ccccc2)(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C36H30O6P/c1-7-19-31(20-8-1)37-43(38-32-21-9-2-10-22-32,39-33-23-11-3-12-24-33,40-34-25-13-4-14-26-34,41-35-27-15-5-16-28-35)42-36-29-17-6-18-30-36/h1-30H/q-1 |
| InChIKey | CMOAVGGCBPKADK-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 23417317 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23417317?
The IUPAC name of CID 23417317 (CID 23417317) is not available.
What is the SMILES notation for CID 23417317?
The canonical SMILES for CID 23417317 is c1ccc(O[P-](Oc2ccccc2)(Oc2ccccc2)(Oc2ccccc2)(Oc2ccccc2)Oc2ccccc2)cc1.
What is the InChIKey of CID 23417317?
The InChIKey is CMOAVGGCBPKADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H30O6P/c1-7-19-31(20-8-1)37-43(38-32-21-9-2-10-22-32,39-33-23-11-3-12-24-33,40-34-25-13-4-14-26-34,41-35-27-15-5-16-28-35)42-36-29-17-6-18-30-36/h1-30H/q-1.
What are the key properties of CID 23417317?
CID 23417317 has a molecular weight of 589.60 g/mol, XLogP of 10.04, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23417317 is sourced from PubChem (CID 23417317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).