About [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane
[[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane (PubChem CID 23417717) has the molecular formula C14H41N2OPSi4
and a molecular weight of 396.81 g/mol. Its IUPAC name is [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane.
Molecular Properties
| Compound Name | [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane |
|---|
| PubChem CID | 23417717 |
|---|
| Molecular Formula | C14H41N2OPSi4 |
|---|
| Molecular Weight | 396.81 g/mol |
|---|
| Exact Mass | 396.20 |
|---|
| IUPAC Name | [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane |
|---|
| SMILES | COP(C[Si](C)(C)C)(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C |
|---|
| InChI | InChI=1S/C14H41N2OPSi4/c1-17-18(14-19(2,3)4,15-20(5,6)7)16(21(8,9)10)22(11,12)13/h14H2,1-13H3 |
|---|
| InChIKey | WKFORLYIRKDHHD-UHFFFAOYSA-N |
|---|
| XLogP | 6.35 |
|---|
| TPSA | 24.83 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 7 |
|---|
| Heavy Atoms | 22 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane?
The IUPAC name of [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane (CID 23417717) is [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane.
What is the SMILES notation for [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane?
The canonical SMILES for [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane is COP(C[Si](C)(C)C)(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane?
The InChIKey is WKFORLYIRKDHHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H41N2OPSi4/c1-17-18(14-19(2,3)4,15-20(5,6)7)16(21(8,9)10)22(11,12)13/h14H2,1-13H3.
What are the key properties of [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane?
[[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane has a molecular weight of 396.81 g/mol, XLogP of 6.35, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[bis(trimethylsilyl)amino]-methoxy-trimethylsilylimino-λ5-phosphanyl]-trimethylsilylmethane is sourced from PubChem (CID 23417717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).