C6H12Cl2N3O4P3 — CID 23417879
15,15-dichloro-1,5,9,13-tetraoxa-7,14,16-triaza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene (PubChem CID 23417879) has the molecular formula C6H12Cl2N3O4P3 and a molecular weight of 354.01 g/mol. Its IUPAC name is 15,15-dichloro-1,5,9,13-tetraoxa-7,14,16-triaza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene.
| Compound Name | 15,15-dichloro-1,5,9,13-tetraoxa-7,14,16-triaza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene |
|---|---|
| PubChem CID | 23417879 |
| Molecular Formula | C6H12Cl2N3O4P3 |
| Molecular Weight | 354.01 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 15,15-dichloro-1,5,9,13-tetraoxa-7,14,16-triaza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene |
| SMILES | ClP1(Cl)=NP2(=NP3(=N1)OCCCO3)OCCCO2 |
| InChI | InChI=1S/C6H12Cl2N3O4P3/c7-16(8)9-17(12-3-1-4-13-17)11-18(10-16)14-5-2-6-15-18/h1-6H2 |
| InChIKey | BJEIJVLBRKOFGE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 74.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.01 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|