C9H17O6P — CID 23418075
1-(2,2,2-trimethoxy-4-methyl-5-methylidene-1,3,2λ5-dioxaphospholan-4-yl)ethanone (PubChem CID 23418075) has the molecular formula C9H17O6P and a molecular weight of 252.20 g/mol. Its IUPAC name is 1-(2,2,2-trimethoxy-4-methyl-5-methylidene-1,3,2λ5-dioxaphospholan-4-yl)ethanone.
| Compound Name | 1-(2,2,2-trimethoxy-4-methyl-5-methylidene-1,3,2λ5-dioxaphospholan-4-yl)ethanone |
|---|---|
| PubChem CID | 23418075 |
| Molecular Formula | C9H17O6P |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-(2,2,2-trimethoxy-4-methyl-5-methylidene-1,3,2λ5-dioxaphospholan-4-yl)ethanone |
| SMILES | C=C1OP(OC)(OC)(OC)OC1(C)C(C)=O |
| InChI | InChI=1S/C9H17O6P/c1-7(10)9(3)8(2)14-16(11-4,12-5,13-6)15-9/h2H2,1,3-6H3 |
| InChIKey | LQLWERFUTRYZIZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|