C20H25O5P — CID 23418250
2,2,2-triethoxy-4,5-diphenyl-1,3,2λ5-dioxaphosphole (PubChem CID 23418250) has the molecular formula C20H25O5P and a molecular weight of 376.39 g/mol. Its IUPAC name is 2,2,2-triethoxy-4,5-diphenyl-1,3,2λ5-dioxaphosphole.
| Compound Name | 2,2,2-triethoxy-4,5-diphenyl-1,3,2λ5-dioxaphosphole |
|---|---|
| PubChem CID | 23418250 |
| Molecular Formula | C20H25O5P |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2,2,2-triethoxy-4,5-diphenyl-1,3,2λ5-dioxaphosphole |
| SMILES | CCOP1(OCC)(OCC)OC(c2ccccc2)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C20H25O5P/c1-4-21-26(22-5-2,23-6-3)24-19(17-13-9-7-10-14-17)20(25-26)18-15-11-8-12-16-18/h7-16H,4-6H2,1-3H3 |
| InChIKey | HLZDASYIVIQWHF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|