About N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine
N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine (PubChem CID 23418432) has the molecular formula C2F8NOP
and a molecular weight of 236.99 g/mol. Its IUPAC name is N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine.
Molecular Properties
| Compound Name | N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine |
| PubChem CID | 23418432 |
| Molecular Formula | C2F8NOP |
| Molecular Weight | 236.99 g/mol |
| Exact Mass | 236.96 |
| IUPAC Name | N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine |
| SMILES | O=P(F)(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C2F8NOP/c3-1(4,5)11(2(6,7)8)13(9,10)12 |
| InChIKey | SRPXFBIUSAOXTF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.99 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine?
The IUPAC name of N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine (CID 23418432) is N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine.
What is the SMILES notation for N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine?
The canonical SMILES for N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine is O=P(F)(F)N(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine?
The InChIKey is SRPXFBIUSAOXTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F8NOP/c3-1(4,5)11(2(6,7)8)13(9,10)12.
What are the key properties of N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine?
N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine has a molecular weight of 236.99 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-difluorophosphoryl-1,1,1-trifluoro-N-(trifluoromethyl)methanamine is sourced from PubChem (CID 23418432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).