C5H6ClF4O3P — CID 23418458
(E)-2-chloro-1-dimethoxyphosphoryl-1,3,3,3-tetrafluoroprop-1-ene (PubChem CID 23418458) has the molecular formula C5H6ClF4O3P and a molecular weight of 256.52 g/mol. Its IUPAC name is (E)-2-chloro-1-dimethoxyphosphoryl-1,3,3,3-tetrafluoroprop-1-ene.
| Compound Name | (E)-2-chloro-1-dimethoxyphosphoryl-1,3,3,3-tetrafluoroprop-1-ene |
|---|---|
| PubChem CID | 23418458 |
| Molecular Formula | C5H6ClF4O3P |
| Molecular Weight | 256.52 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | (E)-2-chloro-1-dimethoxyphosphoryl-1,3,3,3-tetrafluoroprop-1-ene |
| SMILES | COP(=O)(OC)/C(F)=C(/Cl)C(F)(F)F |
| InChI | InChI=1S/C5H6ClF4O3P/c1-12-14(11,13-2)4(7)3(6)5(8,9)10/h1-2H3/b4-3+ |
| InChIKey | ZRQZLYLCYQZXIJ-ONEGZZNKSA-N |
| XLogP | 3.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|