C27H21F3N2O2 — CID 2341858
3-hydroxy-4-(5,6,7,8-tetrahydronaphthalen-1-yliminomethyl)-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 2341858) has the molecular formula C27H21F3N2O2 and a molecular weight of 462.47 g/mol. Its IUPAC name is 3-hydroxy-4-(5,6,7,8-tetrahydronaphthalen-1-yliminomethyl)-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-4-(5,6,7,8-tetrahydronaphthalen-1-yliminomethyl)-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 2341858 |
| Molecular Formula | C27H21F3N2O2 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-hydroxy-4-(5,6,7,8-tetrahydronaphthalen-1-yliminomethyl)-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/c2cccc3c2CCCC3)c(O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H21F3N2O2/c28-27(29,30)18-9-6-10-19(15-18)32-25(33)22-13-4-3-12-21(22)23(26(32)34)16-31-24-14-5-8-17-7-1-2-11-20(17)24/h3-6,8-10,12-16,34H,1-2,7,11H2/b31-16+ |
| InChIKey | CRVJYOGNMTZXSV-WCMJOSRZSA-N |
| XLogP | 6.34 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|