C10H13N2O2PS — CID 23418904
2-ethoxy-3-methyl-5-phenyl-2-sulfanylidene-1,3,4,2λ5-oxadiazaphosphole (PubChem CID 23418904) has the molecular formula C10H13N2O2PS and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-ethoxy-3-methyl-5-phenyl-2-sulfanylidene-1,3,4,2λ5-oxadiazaphosphole.
| Compound Name | 2-ethoxy-3-methyl-5-phenyl-2-sulfanylidene-1,3,4,2λ5-oxadiazaphosphole |
|---|---|
| PubChem CID | 23418904 |
| Molecular Formula | C10H13N2O2PS |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-ethoxy-3-methyl-5-phenyl-2-sulfanylidene-1,3,4,2λ5-oxadiazaphosphole |
| SMILES | CCOP1(=S)OC(c2ccccc2)=NN1C |
| InChI | InChI=1S/C10H13N2O2PS/c1-3-13-15(16)12(2)11-10(14-15)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3 |
| InChIKey | ZPSGEHULBMUXOZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|