C8H11NO9P2-4 — CID 23419762
[(1S,5R,6S)-6-acetamido-5-hydroxy-3-phosphonatocyclohex-3-en-1-yl] phosphate (PubChem CID 23419762) has the molecular formula C8H11NO9P2-4 and a molecular weight of 327.12 g/mol. Its IUPAC name is [(1S,5R,6S)-6-acetamido-5-hydroxy-3-phosphonatocyclohex-3-en-1-yl] phosphate.
| Compound Name | [(1S,5R,6S)-6-acetamido-5-hydroxy-3-phosphonatocyclohex-3-en-1-yl] phosphate |
|---|---|
| PubChem CID | 23419762 |
| Molecular Formula | C8H11NO9P2-4 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | [(1S,5R,6S)-6-acetamido-5-hydroxy-3-phosphonatocyclohex-3-en-1-yl] phosphate |
| SMILES | CC(=O)N[C@H]1[C@H](O)C=C(P(=O)([O-])[O-])C[C@@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C8H15NO9P2/c1-4(10)9-8-6(11)2-5(19(12,13)14)3-7(8)18-20(15,16)17/h2,6-8,11H,3H2,1H3,(H,9,10)(H2,12,13,14)(H2,15,16,17)/p-4/t6-,7+,8+/m1/s1 |
| InChIKey | RNEIQEONNNWQJG-CSMHCCOUSA-J |
| XLogP | -3.73 |
| TPSA | 184.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|