C12H26O4P2 — CID 23420038
2,5,5,8,11,11-hexamethyl-1,3,7,9-tetraoxa-2,8-diphosphacyclododecane (PubChem CID 23420038) has the molecular formula C12H26O4P2 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2,5,5,8,11,11-hexamethyl-1,3,7,9-tetraoxa-2,8-diphosphacyclododecane.
| Compound Name | 2,5,5,8,11,11-hexamethyl-1,3,7,9-tetraoxa-2,8-diphosphacyclododecane |
|---|---|
| PubChem CID | 23420038 |
| Molecular Formula | C12H26O4P2 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2,5,5,8,11,11-hexamethyl-1,3,7,9-tetraoxa-2,8-diphosphacyclododecane |
| SMILES | CP1OCC(C)(C)COP(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C12H26O4P2/c1-11(2)7-13-17(5)15-9-12(3,4)10-16-18(6)14-8-11/h7-10H2,1-6H3 |
| InChIKey | TYMBTJFWYWNAOQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|