O24P8-8 — CID 23421184
2,4,6,8,10,12,14,16-octaoxido-1,3,5,7,9,11,13,15-octaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5,14λ5,16λ5-octaphosphacyclohexadecane 2,4,6,8,10,12,14,16-octaoxide (PubChem CID 23421184) has the molecular formula O24P8-8 and a molecular weight of 631.77 g/mol. Its IUPAC name is 2,4,6,8,10,12,14,16-octaoxido-1,3,5,7,9,11,13,15-octaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5,14λ5,16λ5-octaphosphacyclohexadecane 2,4,6,8,10,12,14,16-octaoxide.
| Compound Name | 2,4,6,8,10,12,14,16-octaoxido-1,3,5,7,9,11,13,15-octaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5,14λ5,16λ5-octaphosphacyclohexadecane 2,4,6,8,10,12,14,16-octaoxide |
|---|---|
| PubChem CID | 23421184 |
| Molecular Formula | O24P8-8 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.67 |
| IUPAC Name | 2,4,6,8,10,12,14,16-octaoxido-1,3,5,7,9,11,13,15-octaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5,14λ5,16λ5-octaphosphacyclohexadecane 2,4,6,8,10,12,14,16-octaoxide |
| SMILES | O=P1([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O1 |
| InChI | InChI=1S/H8O24P8/c1-25(2)17-26(3,4)19-28(7,8)21-30(11,12)23-32(15,16)24-31(13,14)22-29(9,10)20-27(5,6)18-25/h(H,1,2)(H,3,4)(H,5,6)(H,7,8)(H,9,10)(H,11,12)(H,13,14)(H,15,16)/p-8 |
| InChIKey | SHMJBNNEUMMDKQ-UHFFFAOYSA-F |
| XLogP | -4.12 |
| TPSA | 394.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|