C33H39OPSi — CID 23421226
dicyclopentyl-[1-(2-trimethylsilyloxynaphthalen-1-yl)naphthalen-2-yl]phosphane (PubChem CID 23421226) has the molecular formula C33H39OPSi and a molecular weight of 510.73 g/mol. Its IUPAC name is dicyclopentyl-[1-(2-trimethylsilyloxynaphthalen-1-yl)naphthalen-2-yl]phosphane.
| Compound Name | dicyclopentyl-[1-(2-trimethylsilyloxynaphthalen-1-yl)naphthalen-2-yl]phosphane |
|---|---|
| PubChem CID | 23421226 |
| Molecular Formula | C33H39OPSi |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | dicyclopentyl-[1-(2-trimethylsilyloxynaphthalen-1-yl)naphthalen-2-yl]phosphane |
| SMILES | C[Si](C)(C)Oc1ccc2ccccc2c1-c1c(P(C2CCCC2)C2CCCC2)ccc2ccccc12 |
| InChI | InChI=1S/C33H39OPSi/c1-36(2,3)34-30-22-20-24-12-4-10-18-28(24)32(30)33-29-19-11-5-13-25(29)21-23-31(33)35(26-14-6-7-15-26)27-16-8-9-17-27/h4-5,10-13,18-23,26-27H,6-9,14-17H2,1-3H3 |
| InChIKey | MRHLHMOYBXMVRB-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|