C28H27F3NO5P — CID 23421285
diethyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 23421285) has the molecular formula C28H27F3NO5P and a molecular weight of 545.49 g/mol. Its IUPAC name is diethyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | diethyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 23421285 |
| Molecular Formula | C28H27F3NO5P |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | diethyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | CCOC(=O)C(C(NC(=O)C(F)(F)F)C(=O)OCC)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H27F3NO5P/c1-3-36-25(33)23(32-27(35)28(29,30)31)24(26(34)37-4-2)38(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19,23H,3-4H2,1-2H3,(H,32,35) |
| InChIKey | XDYZIKKQPJDSFO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|