C32H35F3NO5P — CID 23421286
ditert-butyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 23421286) has the molecular formula C32H35F3NO5P and a molecular weight of 601.60 g/mol. Its IUPAC name is ditert-butyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | ditert-butyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 23421286 |
| Molecular Formula | C32H35F3NO5P |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | ditert-butyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(NC(=O)C(F)(F)F)C(=O)OC(C)(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H35F3NO5P/c1-30(2,3)40-27(37)25(36-29(39)32(33,34)35)26(28(38)41-31(4,5)6)42(22-16-10-7-11-17-22,23-18-12-8-13-19-23)24-20-14-9-15-21-24/h7-21,25H,1-6H3,(H,36,39) |
| InChIKey | OOXYMXGGIHTJPR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|