About (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane
(2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 23421374) has the molecular formula C27H26NP2S+
and a molecular weight of 458.53 g/mol. Its IUPAC name is (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 23421374 |
| Molecular Formula | C27H26NP2S+ |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(c1ccccc1)(c1ccccc1)N1CCC[P+]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26NP2S/c31-30(26-18-9-3-10-19-26,27-20-11-4-12-21-27)28-22-13-23-29(28,24-14-5-1-6-15-24)25-16-7-2-8-17-25/h1-12,14-21H,13,22-23H2/q+1 |
| InChIKey | CXUKUPQFSFYSEU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The IUPAC name of (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane (CID 23421374) is (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane is S=P(c1ccccc1)(c1ccccc1)N1CCC[P+]1(c1ccccc1)c1ccccc1.
What is the InChIKey of (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The InChIKey is CXUKUPQFSFYSEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26NP2S/c31-30(26-18-9-3-10-19-26,27-20-11-4-12-21-27)28-22-13-23-29(28,24-14-5-1-6-15-24)25-16-7-2-8-17-25/h1-12,14-21H,13,22-23H2/q+1.
What are the key properties of (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane?
(2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane has a molecular weight of 458.53 g/mol, XLogP of 5.32, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-diphenylazaphospholidin-2-ium-1-yl)-diphenyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 23421374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).