About 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine
1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine (PubChem CID 23421377) has the molecular formula C19H22NO4P
and a molecular weight of 359.36 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine |
| PubChem CID | 23421377 |
| Molecular Formula | C19H22NO4P |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine |
| SMILES | CCOP(=O)(OCC)C1ON=C(c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H22NO4P/c1-4-22-25(21,23-5-2)19-17-9-7-6-8-16(17)18(20-24-19)15-12-10-14(3)11-13-15/h6-13,19H,4-5H2,1-3H3 |
| InChIKey | MJOUWNRFBNBSNT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine?
The IUPAC name of 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine (CID 23421377) is 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine.
What is the SMILES notation for 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine?
The canonical SMILES for 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine is CCOP(=O)(OCC)C1ON=C(c2ccc(C)cc2)c2ccccc21.
What is the InChIKey of 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine?
The InChIKey is MJOUWNRFBNBSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22NO4P/c1-4-22-25(21,23-5-2)19-17-9-7-6-8-16(17)18(20-24-19)15-12-10-14(3)11-13-15/h6-13,19H,4-5H2,1-3H3.
What are the key properties of 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine?
1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine has a molecular weight of 359.36 g/mol, XLogP of 5.04, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-4-(4-methylphenyl)-1H-2,3-benzoxazine is sourced from PubChem (CID 23421377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).