C16H19N4O2P — CID 23421418
6-benzyl-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide (PubChem CID 23421418) has the molecular formula C16H19N4O2P and a molecular weight of 330.33 g/mol. Its IUPAC name is 6-benzyl-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide.
| Compound Name | 6-benzyl-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide |
|---|---|
| PubChem CID | 23421418 |
| Molecular Formula | C16H19N4O2P |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 6-benzyl-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide |
| SMILES | CN1N=C(Cc2ccccc2)NN(C)P1(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H19N4O2P/c1-19-17-16(13-14-9-5-3-6-10-14)18-20(2)23(19,21)22-15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,17,18) |
| InChIKey | OMWPBVMLPKTTQB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|