C16H18ClN4O2P — CID 23421420
6-[(4-chlorophenyl)methyl]-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide (PubChem CID 23421420) has the molecular formula C16H18ClN4O2P and a molecular weight of 364.77 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide.
| Compound Name | 6-[(4-chlorophenyl)methyl]-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide |
|---|---|
| PubChem CID | 23421420 |
| Molecular Formula | C16H18ClN4O2P |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide |
| SMILES | CN1N=C(Cc2ccc(Cl)cc2)NN(C)P1(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H18ClN4O2P/c1-20-18-16(12-13-8-10-14(17)11-9-13)19-21(2)24(20,22)23-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,18,19) |
| InChIKey | LSTKIPAMUFWXHI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|