C23H41N2O3PSi2 — CID 23421765
methyl (2S)-2-[[(3aR,7aR)-1,3-bis(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]oxy]-2-phenylacetate (PubChem CID 23421765) has the molecular formula C23H41N2O3PSi2 and a molecular weight of 480.74 g/mol. Its IUPAC name is methyl (2S)-2-[[(3aR,7aR)-1,3-bis(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]oxy]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[[(3aR,7aR)-1,3-bis(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]oxy]-2-phenylacetate |
|---|---|
| PubChem CID | 23421765 |
| Molecular Formula | C23H41N2O3PSi2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | methyl (2S)-2-[[(3aR,7aR)-1,3-bis(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]oxy]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](OP1N(C[Si](C)(C)C)[C@@H]2CCCC[C@H]2N1C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H41N2O3PSi2/c1-27-23(26)22(19-13-9-8-10-14-19)28-29-24(17-30(2,3)4)20-15-11-12-16-21(20)25(29)18-31(5,6)7/h8-10,13-14,20-22H,11-12,15-18H2,1-7H3/t20-,21-,22+/m1/s1 |
| InChIKey | VJFKZQGGBYCQKJ-VSKRKVRLSA-N |
| XLogP | 5.83 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|