C10H20NO5P — CID 23421847
(Z)-1-diethoxyphosphoryl-2,3-dimethyl-3-nitrobut-1-ene (PubChem CID 23421847) has the molecular formula C10H20NO5P and a molecular weight of 265.25 g/mol. Its IUPAC name is (Z)-1-diethoxyphosphoryl-2,3-dimethyl-3-nitrobut-1-ene.
| Compound Name | (Z)-1-diethoxyphosphoryl-2,3-dimethyl-3-nitrobut-1-ene |
|---|---|
| PubChem CID | 23421847 |
| Molecular Formula | C10H20NO5P |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (Z)-1-diethoxyphosphoryl-2,3-dimethyl-3-nitrobut-1-ene |
| SMILES | CCOP(=O)(/C=C(/C)C(C)(C)[N+](=O)[O-])OCC |
| InChI | InChI=1S/C10H20NO5P/c1-6-15-17(14,16-7-2)8-9(3)10(4,5)11(12)13/h8H,6-7H2,1-5H3/b9-8- |
| InChIKey | HUFCIPNAXWZUHO-HJWRWDBZSA-N |
| XLogP | 3.21 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|