C10H18NO7P — CID 23421920
2-[(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methoxy]-1,3,2-dioxaphosphinane (PubChem CID 23421920) has the molecular formula C10H18NO7P and a molecular weight of 295.23 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methoxy]-1,3,2-dioxaphosphinane.
| Compound Name | 2-[(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methoxy]-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 23421920 |
| Molecular Formula | C10H18NO7P |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-[(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methoxy]-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)OCC(COP2OCCCO2)([N+](=O)[O-])CO1 |
| InChI | InChI=1S/C10H18NO7P/c1-9(2)14-6-10(7-15-9,11(12)13)8-18-19-16-4-3-5-17-19/h3-8H2,1-2H3 |
| InChIKey | HPNKISUWQAGGMY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|