C24H27F10O4PSi — CID 23421954
(2-fluorophenyl) (3,3,4,4,5,5,6,6,6-nonafluoro-1-trimethylsilylhexan-2-yl) (4-propan-2-ylphenyl) phosphate (PubChem CID 23421954) has the molecular formula C24H27F10O4PSi and a molecular weight of 628.52 g/mol. Its IUPAC name is (2-fluorophenyl) (3,3,4,4,5,5,6,6,6-nonafluoro-1-trimethylsilylhexan-2-yl) (4-propan-2-ylphenyl) phosphate.
| Compound Name | (2-fluorophenyl) (3,3,4,4,5,5,6,6,6-nonafluoro-1-trimethylsilylhexan-2-yl) (4-propan-2-ylphenyl) phosphate |
|---|---|
| PubChem CID | 23421954 |
| Molecular Formula | C24H27F10O4PSi |
| Molecular Weight | 628.52 g/mol |
| Exact Mass | 628.13 |
| IUPAC Name | (2-fluorophenyl) (3,3,4,4,5,5,6,6,6-nonafluoro-1-trimethylsilylhexan-2-yl) (4-propan-2-ylphenyl) phosphate |
| SMILES | CC(C)c1ccc(OP(=O)(Oc2ccccc2F)OC(C[Si](C)(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H27F10O4PSi/c1-15(2)16-10-12-17(13-11-16)36-39(35,37-19-9-7-6-8-18(19)25)38-20(14-40(3,4)5)21(26,27)22(28,29)23(30,31)24(32,33)34/h6-13,15,20H,14H2,1-5H3 |
| InChIKey | WMQTUJKKWSKBRA-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.52 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|