About 4-methoxypteridine
4-methoxypteridine (PubChem CID 23422065) has the molecular formula C7H6N4O
and a molecular weight of 162.15 g/mol. Its IUPAC name is 4-methoxypteridine.
Molecular Properties
| Compound Name | 4-methoxypteridine |
| PubChem CID | 23422065 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 4-methoxypteridine |
| SMILES | COc1ncnc2nccnc12 |
| InChI | InChI=1S/C7H6N4O/c1-12-7-5-6(10-4-11-7)9-3-2-8-5/h2-4H,1H3 |
| InChIKey | KCCOKUSVNPDIBJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxypteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxypteridine?
The IUPAC name of 4-methoxypteridine (CID 23422065) is 4-methoxypteridine.
What is the SMILES notation for 4-methoxypteridine?
The canonical SMILES for 4-methoxypteridine is COc1ncnc2nccnc12.
What is the InChIKey of 4-methoxypteridine?
The InChIKey is KCCOKUSVNPDIBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O/c1-12-7-5-6(10-4-11-7)9-3-2-8-5/h2-4H,1H3.
What are the key properties of 4-methoxypteridine?
4-methoxypteridine has a molecular weight of 162.15 g/mol, XLogP of 0.43, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxypteridine is sourced from PubChem (CID 23422065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).