2-[(5-aminopyrimidin-4-yl)amino]acetic acid

C6H8N4O2 — CID 23422082

IUPAC2-[(5-aminopyrimidin-4-yl)amino]acetic acid
SMILESNc1cncnc1NCC(=O)O
InChIInChI=1S/C6H8N4O2/c7-4-1-8-3-10-6(4)9-2-5(11)12/h1,3H,2,7H2,(H,11,12)(H,8,9,10)
InChIKeyHDNXMNFEXORIOL-UHFFFAOYSA-N
MW168.16 g/mol
LogP-0.44
Rot. Bonds3

About 2-[(5-aminopyrimidin-4-yl)amino]acetic acid

2-[(5-aminopyrimidin-4-yl)amino]acetic acid (PubChem CID 23422082) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is 2-[(5-aminopyrimidin-4-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(5-aminopyrimidin-4-yl)amino]acetic acid
PubChem CID23422082
Molecular FormulaC6H8N4O2
Molecular Weight168.16 g/mol
Exact Mass168.06
IUPAC Name2-[(5-aminopyrimidin-4-yl)amino]acetic acid
SMILESNc1cncnc1NCC(=O)O
InChIInChI=1S/C6H8N4O2/c7-4-1-8-3-10-6(4)9-2-5(11)12/h1,3H,2,7H2,(H,11,12)(H,8,9,10)
InChIKeyHDNXMNFEXORIOL-UHFFFAOYSA-N
XLogP-0.44
TPSA101.13 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.16
LogP ≤ 5-0.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[(5-aminopyrimidin-4-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-aminopyrimidin-4-yl)amino]acetic acid?
The IUPAC name of 2-[(5-aminopyrimidin-4-yl)amino]acetic acid (CID 23422082) is 2-[(5-aminopyrimidin-4-yl)amino]acetic acid.
What is the SMILES notation for 2-[(5-aminopyrimidin-4-yl)amino]acetic acid?
The canonical SMILES for 2-[(5-aminopyrimidin-4-yl)amino]acetic acid is Nc1cncnc1NCC(=O)O.
What is the InChIKey of 2-[(5-aminopyrimidin-4-yl)amino]acetic acid?
The InChIKey is HDNXMNFEXORIOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c7-4-1-8-3-10-6(4)9-2-5(11)12/h1,3H,2,7H2,(H,11,12)(H,8,9,10).
What are the key properties of 2-[(5-aminopyrimidin-4-yl)amino]acetic acid?
2-[(5-aminopyrimidin-4-yl)amino]acetic acid has a molecular weight of 168.16 g/mol, XLogP of -0.44, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-aminopyrimidin-4-yl)amino]acetic acid is sourced from PubChem (CID 23422082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).