C5H8N4S — CID 23422084
2-methylsulfanylpyrimidine-4,5-diamine (PubChem CID 23422084) has the molecular formula C5H8N4S and a molecular weight of 156.21 g/mol. Its IUPAC name is 2-methylsulfanylpyrimidine-4,5-diamine.
| Compound Name | 2-methylsulfanylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 23422084 |
| Molecular Formula | C5H8N4S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-methylsulfanylpyrimidine-4,5-diamine |
| SMILES | CSc1ncc(N)c(N)n1 |
| InChI | InChI=1S/C5H8N4S/c1-10-5-8-2-3(6)4(7)9-5/h2H,6H2,1H3,(H2,7,8,9) |
| InChIKey | POCJMDVPRFEHNI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |