About 4aH-pteridine-2,4-dione
4aH-pteridine-2,4-dione (PubChem CID 23422119) has the molecular formula C6H4N4O2
and a molecular weight of 164.12 g/mol. Its IUPAC name is 4aH-pteridine-2,4-dione.
Molecular Properties
| Compound Name | 4aH-pteridine-2,4-dione |
| PubChem CID | 23422119 |
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 4aH-pteridine-2,4-dione |
| SMILES | O=C1N=C2N=CC=NC2C(=O)N1 |
| InChI | InChI=1S/C6H4N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h1-3H,(H,10,11,12) |
| InChIKey | QFHCUBWSAYWACR-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4aH-pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4aH-pteridine-2,4-dione?
The IUPAC name of 4aH-pteridine-2,4-dione (CID 23422119) is 4aH-pteridine-2,4-dione.
What is the SMILES notation for 4aH-pteridine-2,4-dione?
The canonical SMILES for 4aH-pteridine-2,4-dione is O=C1N=C2N=CC=NC2C(=O)N1.
What is the InChIKey of 4aH-pteridine-2,4-dione?
The InChIKey is QFHCUBWSAYWACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h1-3H,(H,10,11,12).
What are the key properties of 4aH-pteridine-2,4-dione?
4aH-pteridine-2,4-dione has a molecular weight of 164.12 g/mol, XLogP of -0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4aH-pteridine-2,4-dione is sourced from PubChem (CID 23422119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).