About 1-methylpyrimidine-2,4-dithione
1-methylpyrimidine-2,4-dithione (PubChem CID 23422236) has the molecular formula C5H6N2S2
and a molecular weight of 158.25 g/mol. Its IUPAC name is 1-methylpyrimidine-2,4-dithione.
Molecular Properties
| Compound Name | 1-methylpyrimidine-2,4-dithione |
| PubChem CID | 23422236 |
| Molecular Formula | C5H6N2S2 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | 1-methylpyrimidine-2,4-dithione |
| SMILES | Cn1ccc(=S)[nH]c1=S |
| InChI | InChI=1S/C5H6N2S2/c1-7-3-2-4(8)6-5(7)9/h2-3H,1H3,(H,6,8,9) |
| InChIKey | BCFZTQWXIRAAFQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrimidine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrimidine-2,4-dithione?
The IUPAC name of 1-methylpyrimidine-2,4-dithione (CID 23422236) is 1-methylpyrimidine-2,4-dithione.
What is the SMILES notation for 1-methylpyrimidine-2,4-dithione?
The canonical SMILES for 1-methylpyrimidine-2,4-dithione is Cn1ccc(=S)[nH]c1=S.
What is the InChIKey of 1-methylpyrimidine-2,4-dithione?
The InChIKey is BCFZTQWXIRAAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2S2/c1-7-3-2-4(8)6-5(7)9/h2-3H,1H3,(H,6,8,9).
What are the key properties of 1-methylpyrimidine-2,4-dithione?
1-methylpyrimidine-2,4-dithione has a molecular weight of 158.25 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrimidine-2,4-dithione is sourced from PubChem (CID 23422236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).