About 7,9-dimethylpurin-8-one
7,9-dimethylpurin-8-one (PubChem CID 23422304) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 7,9-dimethylpurin-8-one.
Molecular Properties
| Compound Name | 7,9-dimethylpurin-8-one |
| PubChem CID | 23422304 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 7,9-dimethylpurin-8-one |
| SMILES | Cn1c(=O)n(C)c2ncncc21 |
| InChI | InChI=1S/C7H8N4O/c1-10-5-3-8-4-9-6(5)11(2)7(10)12/h3-4H,1-2H3 |
| InChIKey | XUJHLVLIGDUYDV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7,9-dimethylpurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dimethylpurin-8-one?
The IUPAC name of 7,9-dimethylpurin-8-one (CID 23422304) is 7,9-dimethylpurin-8-one.
What is the SMILES notation for 7,9-dimethylpurin-8-one?
The canonical SMILES for 7,9-dimethylpurin-8-one is Cn1c(=O)n(C)c2ncncc21.
What is the InChIKey of 7,9-dimethylpurin-8-one?
The InChIKey is XUJHLVLIGDUYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-10-5-3-8-4-9-6(5)11(2)7(10)12/h3-4H,1-2H3.
What are the key properties of 7,9-dimethylpurin-8-one?
7,9-dimethylpurin-8-one has a molecular weight of 164.17 g/mol, XLogP of -0.33, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dimethylpurin-8-one is sourced from PubChem (CID 23422304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).